C13H17N3O4S — CID 106098233
3-[[5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]sulfonylamino]-3-methylbutanamide (PubChem CID 106098233) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-[[5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]sulfonylamino]-3-methylbutanamide.
| Compound Name | 3-[[5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106098233 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-[[5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)NS(=O)(=O)c1cncc(C#CCO)c1 |
| InChI | InChI=1S/C13H17N3O4S/c1-13(2,7-12(14)18)16-21(19,20)11-6-10(4-3-5-17)8-15-9-11/h6,8-9,16-17H,5,7H2,1-2H3,(H2,14,18) |
| InChIKey | SBPNLTYFNQYIAM-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|