C12H16ClN3O3S2 — CID 106096774
3-[(4-carbamothioyl-3-chlorophenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 106096774) has the molecular formula C12H16ClN3O3S2 and a molecular weight of 349.87 g/mol. Its IUPAC name is 3-[(4-carbamothioyl-3-chlorophenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | 3-[(4-carbamothioyl-3-chlorophenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106096774 |
| Molecular Formula | C12H16ClN3O3S2 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 3-[(4-carbamothioyl-3-chlorophenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)NS(=O)(=O)c1ccc(C(N)=S)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClN3O3S2/c1-12(2,6-10(14)17)16-21(18,19)7-3-4-8(11(15)20)9(13)5-7/h3-5,16H,6H2,1-2H3,(H2,14,17)(H2,15,20) |
| InChIKey | MXKLPGGUNVCOKD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|