C13H19ClN2O2S2 — CID 104828407
2-chloro-4-(3,3-dimethylbutan-2-ylsulfamoyl)benzenecarbothioamide (PubChem CID 104828407) has the molecular formula C13H19ClN2O2S2 and a molecular weight of 334.89 g/mol. Its IUPAC name is 2-chloro-4-(3,3-dimethylbutan-2-ylsulfamoyl)benzenecarbothioamide.
| Compound Name | 2-chloro-4-(3,3-dimethylbutan-2-ylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 104828407 |
| Molecular Formula | C13H19ClN2O2S2 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-chloro-4-(3,3-dimethylbutan-2-ylsulfamoyl)benzenecarbothioamide |
| SMILES | CC(NS(=O)(=O)c1ccc(C(N)=S)c(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C13H19ClN2O2S2/c1-8(13(2,3)4)16-20(17,18)9-5-6-10(12(15)19)11(14)7-9/h5-8,16H,1-4H3,(H2,15,19) |
| InChIKey | HUMKHFFDCKPWPW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|