C12H19N3O2S2 — CID 106597826
3-(3,3-dimethylbutan-2-ylsulfamoyl)pyridine-2-carbothioamide (PubChem CID 106597826) has the molecular formula C12H19N3O2S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 3-(3,3-dimethylbutan-2-ylsulfamoyl)pyridine-2-carbothioamide.
| Compound Name | 3-(3,3-dimethylbutan-2-ylsulfamoyl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 106597826 |
| Molecular Formula | C12H19N3O2S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-(3,3-dimethylbutan-2-ylsulfamoyl)pyridine-2-carbothioamide |
| SMILES | CC(NS(=O)(=O)c1cccnc1C(N)=S)C(C)(C)C |
| InChI | InChI=1S/C12H19N3O2S2/c1-8(12(2,3)4)15-19(16,17)9-6-5-7-14-10(9)11(13)18/h5-8,15H,1-4H3,(H2,13,18) |
| InChIKey | RMIFQFBGRAPTCH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|