C12H17N3O4S2 — CID 106596603
methyl 2-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]-3-methylbutanoate (PubChem CID 106596603) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is methyl 2-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | methyl 2-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 106596603 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | methyl 2-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]-3-methylbutanoate |
| SMILES | COC(=O)C(NS(=O)(=O)c1cccnc1C(N)=S)C(C)C |
| InChI | InChI=1S/C12H17N3O4S2/c1-7(2)9(12(16)19-3)15-21(17,18)8-5-4-6-14-10(8)11(13)20/h4-7,9,15H,1-3H3,(H2,13,20) |
| InChIKey | JKCQTTPCVKBXRO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|