C15H18Cl2N2O2S — CID 54332135
1,4-dichloro-N-[(2S)-3,3-dimethylbutan-2-yl]isoquinoline-7-sulfonamide (PubChem CID 54332135) has the molecular formula C15H18Cl2N2O2S and a molecular weight of 361.29 g/mol. Its IUPAC name is 1,4-dichloro-N-[(2S)-3,3-dimethylbutan-2-yl]isoquinoline-7-sulfonamide.
| Compound Name | 1,4-dichloro-N-[(2S)-3,3-dimethylbutan-2-yl]isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 54332135 |
| Molecular Formula | C15H18Cl2N2O2S |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1,4-dichloro-N-[(2S)-3,3-dimethylbutan-2-yl]isoquinoline-7-sulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc2c(Cl)cnc(Cl)c2c1)C(C)(C)C |
| InChI | InChI=1S/C15H18Cl2N2O2S/c1-9(15(2,3)4)19-22(20,21)10-5-6-11-12(7-10)14(17)18-8-13(11)16/h5-9,19H,1-4H3/t9-/m0/s1 |
| InChIKey | SZBVGCTYWCSWND-VIFPVBQESA-N |
| XLogP | 4.25 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|