C17H17ClF3N5O5S — CID 87992422
(2,2,2-trifluoroacetyl) (2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3-methylbutanoate (PubChem CID 87992422) has the molecular formula C17H17ClF3N5O5S and a molecular weight of 495.87 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3-methylbutanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 87992422 |
| Molecular Formula | C17H17ClF3N5O5S |
| Molecular Weight | 495.87 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc2c(Cl)cnc(N=C(N)N)c2c1)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H17ClF3N5O5S/c1-7(2)12(14(27)31-15(28)17(19,20)21)26-32(29,30)8-3-4-9-10(5-8)13(25-16(22)23)24-6-11(9)18/h3-7,12,26H,1-2H3,(H4,22,23,24,25)/t12-/m0/s1 |
| InChIKey | PSIHIIDLNRJURD-LBPRGKRZSA-N |
| XLogP | 1.73 |
| TPSA | 166.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.87 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|