C21H17ClF3N5O5S — CID 87991956
[2-[benzyl-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]acetyl] 2,2,2-trifluoroacetate (PubChem CID 87991956) has the molecular formula C21H17ClF3N5O5S and a molecular weight of 543.91 g/mol. Its IUPAC name is [2-[benzyl-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[benzyl-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87991956 |
| Molecular Formula | C21H17ClF3N5O5S |
| Molecular Weight | 543.91 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | [2-[benzyl-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]acetyl] 2,2,2-trifluoroacetate |
| SMILES | NC(N)=Nc1ncc(Cl)c2ccc(S(=O)(=O)N(CC(=O)OC(=O)C(F)(F)F)Cc3ccccc3)cc12 |
| InChI | InChI=1S/C21H17ClF3N5O5S/c22-16-9-28-18(29-20(26)27)15-8-13(6-7-14(15)16)36(33,34)30(10-12-4-2-1-3-5-12)11-17(31)35-19(32)21(23,24)25/h1-9H,10-11H2,(H4,26,27,28,29) |
| InChIKey | MILUPSPNTCHFOU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 158.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.91 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|