C19H24ClN5O4S — CID 18698405
2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonyl-(cyclohexylmethyl)amino]acetic acid (PubChem CID 18698405) has the molecular formula C19H24ClN5O4S and a molecular weight of 453.95 g/mol. Its IUPAC name is 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonyl-(cyclohexylmethyl)amino]acetic acid.
| Compound Name | 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonyl-(cyclohexylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 18698405 |
| Molecular Formula | C19H24ClN5O4S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonyl-(cyclohexylmethyl)amino]acetic acid |
| SMILES | NC(N)=Nc1ncc(Cl)c2ccc(S(=O)(=O)N(CC(=O)O)CC3CCCCC3)cc12 |
| InChI | InChI=1S/C19H24ClN5O4S/c20-16-9-23-18(24-19(21)22)15-8-13(6-7-14(15)16)30(28,29)25(11-17(26)27)10-12-4-2-1-3-5-12/h6-9,12H,1-5,10-11H2,(H,26,27)(H4,21,22,23,24) |
| InChIKey | DUSOHEUFUBHXJJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|