About tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate
tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate (PubChem CID 16658469) has the molecular formula C21H26Cl2N2O4S
and a molecular weight of 473.42 g/mol. Its IUPAC name is tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate |
| PubChem CID | 16658469 |
| Molecular Formula | C21H26Cl2N2O4S |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(CC1CCCC1)S(=O)(=O)c1ccc2c(Cl)cnc(Cl)c2c1 |
| InChI | InChI=1S/C21H26Cl2N2O4S/c1-21(2,3)29-19(26)13-25(12-14-6-4-5-7-14)30(27,28)15-8-9-16-17(10-15)20(23)24-11-18(16)22/h8-11,14H,4-7,12-13H2,1-3H3 |
| InChIKey | FCDMLRKFOHKYJF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate?
The IUPAC name of tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate (CID 16658469) is tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate.
What is the SMILES notation for tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate?
The canonical SMILES for tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate is CC(C)(C)OC(=O)CN(CC1CCCC1)S(=O)(=O)c1ccc2c(Cl)cnc(Cl)c2c1.
What is the InChIKey of tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate?
The InChIKey is FCDMLRKFOHKYJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26Cl2N2O4S/c1-21(2,3)29-19(26)13-25(12-14-6-4-5-7-14)30(27,28)15-8-9-16-17(10-15)20(23)24-11-18(16)22/h8-11,14H,4-7,12-13H2,1-3H3.
What are the key properties of tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate?
tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate has a molecular weight of 473.42 g/mol, XLogP of 5.06, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[cyclopentylmethyl-(1,4-dichloroisoquinolin-7-yl)sulfonylamino]acetate is sourced from PubChem (CID 16658469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).