About tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate
tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate (PubChem CID 18698356) has the molecular formula C23H22Cl2N2O3
and a molecular weight of 445.35 g/mol. Its IUPAC name is tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate |
| PubChem CID | 18698356 |
| Molecular Formula | C23H22Cl2N2O3 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(Cc1ccccc1)C(=O)c1ccc2c(Cl)cnc(Cl)c2c1 |
| InChI | InChI=1S/C23H22Cl2N2O3/c1-23(2,3)30-20(28)14-27(13-15-7-5-4-6-8-15)22(29)16-9-10-17-18(11-16)21(25)26-12-19(17)24/h4-12H,13-14H2,1-3H3 |
| InChIKey | HEZYTOYOFOPUPN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate?
The IUPAC name of tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate (CID 18698356) is tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate.
What is the SMILES notation for tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate?
The canonical SMILES for tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate is CC(C)(C)OC(=O)CN(Cc1ccccc1)C(=O)c1ccc2c(Cl)cnc(Cl)c2c1.
What is the InChIKey of tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate?
The InChIKey is HEZYTOYOFOPUPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22Cl2N2O3/c1-23(2,3)30-20(28)14-27(13-15-7-5-4-6-8-15)22(29)16-9-10-17-18(11-16)21(25)26-12-19(17)24/h4-12H,13-14H2,1-3H3.
What are the key properties of tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate?
tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate has a molecular weight of 445.35 g/mol, XLogP of 5.53, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[benzyl-(1,4-dichloroisoquinoline-7-carbonyl)amino]acetate is sourced from PubChem (CID 18698356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).