C19H16Cl2N2O2 — CID 149150681
2-[benzyl-[(1,4-dichloroisoquinolin-7-yl)methyl]amino]acetic acid (PubChem CID 149150681) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is 2-[benzyl-[(1,4-dichloroisoquinolin-7-yl)methyl]amino]acetic acid.
| Compound Name | 2-[benzyl-[(1,4-dichloroisoquinolin-7-yl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 149150681 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 2-[benzyl-[(1,4-dichloroisoquinolin-7-yl)methyl]amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccccc1)Cc1ccc2c(Cl)cnc(Cl)c2c1 |
| InChI | InChI=1S/C19H16Cl2N2O2/c20-17-9-22-19(21)16-8-14(6-7-15(16)17)11-23(12-18(24)25)10-13-4-2-1-3-5-13/h1-9H,10-12H2,(H,24,25) |
| InChIKey | PVSMGMIQTFYTLG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|