C29H20Cl5N3O2 — CID 160572687
1,4-dichloroisoquinoline-7-carbonyl chloride;1,4-dichloro-N-(1-phenylpropan-2-yl)isoquinoline-7-carboxamide (PubChem CID 160572687) has the molecular formula C29H20Cl5N3O2 and a molecular weight of 619.76 g/mol. Its IUPAC name is 1,4-dichloroisoquinoline-7-carbonyl chloride;1,4-dichloro-N-(1-phenylpropan-2-yl)isoquinoline-7-carboxamide.
| Compound Name | 1,4-dichloroisoquinoline-7-carbonyl chloride;1,4-dichloro-N-(1-phenylpropan-2-yl)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 160572687 |
| Molecular Formula | C29H20Cl5N3O2 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 617.00 |
| IUPAC Name | 1,4-dichloroisoquinoline-7-carbonyl chloride;1,4-dichloro-N-(1-phenylpropan-2-yl)isoquinoline-7-carboxamide |
| SMILES | CC(Cc1ccccc1)NC(=O)c1ccc2c(Cl)cnc(Cl)c2c1.O=C(Cl)c1ccc2c(Cl)cnc(Cl)c2c1 |
| InChI | InChI=1S/C19H16Cl2N2O.C10H4Cl3NO/c1-12(9-13-5-3-2-4-6-13)23-19(24)14-7-8-15-16(10-14)18(21)22-11-17(15)20;11-8-4-14-9(12)7-3-5(10(13)15)1-2-6(7)8/h2-8,10-12H,9H2,1H3,(H,23,24);1-4H |
| InChIKey | RATFCRBRGCFQJK-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|