C16H17NOS — CID 107029231
N-(1-phenylpropan-2-yl)-4-sulfanylbenzamide (PubChem CID 107029231) has the molecular formula C16H17NOS and a molecular weight of 271.39 g/mol. Its IUPAC name is N-(1-phenylpropan-2-yl)-4-sulfanylbenzamide.
| Compound Name | N-(1-phenylpropan-2-yl)-4-sulfanylbenzamide |
|---|---|
| PubChem CID | 107029231 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(1-phenylpropan-2-yl)-4-sulfanylbenzamide |
| SMILES | CC(Cc1ccccc1)NC(=O)c1ccc(S)cc1 |
| InChI | InChI=1S/C16H17NOS/c1-12(11-13-5-3-2-4-6-13)17-16(18)14-7-9-15(19)10-8-14/h2-10,12,19H,11H2,1H3,(H,17,18) |
| InChIKey | DTFGMTCWYYSDOX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|