C11H14N2O2S — CID 107035767
N-(4-amino-4-oxobutan-2-yl)-4-sulfanylbenzamide (PubChem CID 107035767) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is N-(4-amino-4-oxobutan-2-yl)-4-sulfanylbenzamide.
| Compound Name | N-(4-amino-4-oxobutan-2-yl)-4-sulfanylbenzamide |
|---|---|
| PubChem CID | 107035767 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | N-(4-amino-4-oxobutan-2-yl)-4-sulfanylbenzamide |
| SMILES | CC(CC(N)=O)NC(=O)c1ccc(S)cc1 |
| InChI | InChI=1S/C11H14N2O2S/c1-7(6-10(12)14)13-11(15)8-2-4-9(16)5-3-8/h2-5,7,16H,6H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | YBIUKGKDFNXSBM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|