C25H36N2O — CID 129361894
4-[(dibutylamino)methyl]-N-[(2R)-1-phenylpropan-2-yl]benzamide (PubChem CID 129361894) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is 4-[(dibutylamino)methyl]-N-[(2R)-1-phenylpropan-2-yl]benzamide.
| Compound Name | 4-[(dibutylamino)methyl]-N-[(2R)-1-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 129361894 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 4-[(dibutylamino)methyl]-N-[(2R)-1-phenylpropan-2-yl]benzamide |
| SMILES | CCCCN(CCCC)Cc1ccc(C(=O)N[C@H](C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H36N2O/c1-4-6-17-27(18-7-5-2)20-23-13-15-24(16-14-23)25(28)26-21(3)19-22-11-9-8-10-12-22/h8-16,21H,4-7,17-20H2,1-3H3,(H,26,28)/t21-/m1/s1 |
| InChIKey | XCUDLNSWDGYQQZ-OAQYLSRUSA-N |
| XLogP | 5.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |