C23H26ClN5O4S — CID 170987392
tert-butyl 2-[benzyl-[4-chloro-1-(hydrazinylmethylideneamino)isoquinolin-7-yl]sulfonylamino]acetate (PubChem CID 170987392) has the molecular formula C23H26ClN5O4S and a molecular weight of 504.01 g/mol. Its IUPAC name is tert-butyl 2-[benzyl-[4-chloro-1-(hydrazinylmethylideneamino)isoquinolin-7-yl]sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[benzyl-[4-chloro-1-(hydrazinylmethylideneamino)isoquinolin-7-yl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 170987392 |
| Molecular Formula | C23H26ClN5O4S |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | tert-butyl 2-[benzyl-[4-chloro-1-(hydrazinylmethylideneamino)isoquinolin-7-yl]sulfonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(Cc1ccccc1)S(=O)(=O)c1ccc2c(Cl)cnc(/N=C/NN)c2c1 |
| InChI | InChI=1S/C23H26ClN5O4S/c1-23(2,3)33-21(30)14-29(13-16-7-5-4-6-8-16)34(31,32)17-9-10-18-19(11-17)22(27-15-28-25)26-12-20(18)24/h4-12,15H,13-14,25H2,1-3H3,(H,26,27,28) |
| InChIKey | AJQKHHIHVXINKQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|