C23H25Cl2N5O4S — CID 70137886
butyl 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonyl-[(3-chlorophenyl)methyl]amino]acetate (PubChem CID 70137886) has the molecular formula C23H25Cl2N5O4S and a molecular weight of 538.46 g/mol. Its IUPAC name is butyl 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonyl-[(3-chlorophenyl)methyl]amino]acetate.
| Compound Name | butyl 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonyl-[(3-chlorophenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 70137886 |
| Molecular Formula | C23H25Cl2N5O4S |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | butyl 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonyl-[(3-chlorophenyl)methyl]amino]acetate |
| SMILES | CCCCOC(=O)CN(Cc1cccc(Cl)c1)S(=O)(=O)c1ccc2c(Cl)cnc(N=C(N)N)c2c1 |
| InChI | InChI=1S/C23H25Cl2N5O4S/c1-2-3-9-34-21(31)14-30(13-15-5-4-6-16(24)10-15)35(32,33)17-7-8-18-19(11-17)22(29-23(26)27)28-12-20(18)25/h4-8,10-12H,2-3,9,13-14H2,1H3,(H4,26,27,28,29) |
| InChIKey | JHAYBQDIJFNICX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|