C21H16Cl2F3N5O5S — CID 173251820
[2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonyl-[(3-chlorophenyl)methyl]amino]acetyl] 2,2,2-trifluoroacetate (PubChem CID 173251820) has the molecular formula C21H16Cl2F3N5O5S and a molecular weight of 578.36 g/mol. Its IUPAC name is [2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonyl-[(3-chlorophenyl)methyl]amino]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonyl-[(3-chlorophenyl)methyl]amino]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 173251820 |
| Molecular Formula | C21H16Cl2F3N5O5S |
| Molecular Weight | 578.36 g/mol |
| Exact Mass | 577.02 |
| IUPAC Name | [2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonyl-[(3-chlorophenyl)methyl]amino]acetyl] 2,2,2-trifluoroacetate |
| SMILES | NC(=NCl)Nc1cncc2cc(S(=O)(=O)N(CC(=O)OC(=O)C(F)(F)F)Cc3cccc(Cl)c3)ccc12 |
| InChI | InChI=1S/C21H16Cl2F3N5O5S/c22-14-3-1-2-12(6-14)10-31(11-18(32)36-19(33)21(24,25)26)37(34,35)15-4-5-16-13(7-15)8-28-9-17(16)29-20(27)30-23/h1-9H,10-11H2,(H3,27,29,30) |
| InChIKey | QSJILCXZKVNYKD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|