C14H18Cl2N6O3S — CID 70070046
2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanamide;hydrochloride (PubChem CID 70070046) has the molecular formula C14H18Cl2N6O3S and a molecular weight of 421.31 g/mol. Its IUPAC name is 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanamide;hydrochloride.
| Compound Name | 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 70070046 |
| Molecular Formula | C14H18Cl2N6O3S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-[[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]-2-methylpropanamide;hydrochloride |
| SMILES | CC(C)(NS(=O)(=O)c1ccc2c(NC(N)=NCl)cncc2c1)C(N)=O.Cl |
| InChI | InChI=1S/C14H17ClN6O3S.ClH/c1-14(2,12(16)22)21-25(23,24)9-3-4-10-8(5-9)6-18-7-11(10)19-13(17)20-15;/h3-7,21H,1-2H3,(H2,16,22)(H3,17,19,20);1H |
| InChIKey | YSSKMGBJUCTNGH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|