C23H27ClN6O4S — CID 57300108
1-[2-[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylpyrrol-2-yl]-N-(2-methoxyethyl)cyclopentane-1-carboxamide (PubChem CID 57300108) has the molecular formula C23H27ClN6O4S and a molecular weight of 519.03 g/mol. Its IUPAC name is 1-[2-[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylpyrrol-2-yl]-N-(2-methoxyethyl)cyclopentane-1-carboxamide.
| Compound Name | 1-[2-[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylpyrrol-2-yl]-N-(2-methoxyethyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 57300108 |
| Molecular Formula | C23H27ClN6O4S |
| Molecular Weight | 519.03 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 1-[2-[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylpyrrol-2-yl]-N-(2-methoxyethyl)cyclopentane-1-carboxamide |
| SMILES | COCCNC(=O)C1(C2(S(=O)(=O)c3ccc4c(NC(N)=NCl)cncc4c3)C=CC=N2)CCCC1 |
| InChI | InChI=1S/C23H27ClN6O4S/c1-34-12-11-27-20(31)22(7-2-3-8-22)23(9-4-10-28-23)35(32,33)17-5-6-18-16(13-17)14-26-15-19(18)29-21(25)30-24/h4-6,9-10,13-15H,2-3,7-8,11-12H2,1H3,(H,27,31)(H3,25,29,30) |
| InChIKey | JEPOJLBOCQBFHL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.03 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|