C15H19Cl2N5O3S — CID 70072006
2-chloro-1-[7-[2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylisoquinolin-4-yl]guanidine;hydrochloride (PubChem CID 70072006) has the molecular formula C15H19Cl2N5O3S and a molecular weight of 420.32 g/mol. Its IUPAC name is 2-chloro-1-[7-[2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylisoquinolin-4-yl]guanidine;hydrochloride.
| Compound Name | 2-chloro-1-[7-[2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylisoquinolin-4-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 70072006 |
| Molecular Formula | C15H19Cl2N5O3S |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-chloro-1-[7-[2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylisoquinolin-4-yl]guanidine;hydrochloride |
| SMILES | Cl.NC(=NCl)Nc1cncc2cc(S(=O)(=O)N3CCCC3CO)ccc12 |
| InChI | InChI=1S/C15H18ClN5O3S.ClH/c16-20-15(17)19-14-8-18-7-10-6-12(3-4-13(10)14)25(23,24)21-5-1-2-11(21)9-22;/h3-4,6-8,11,22H,1-2,5,9H2,(H3,17,19,20);1H |
| InChIKey | ZKUWVNZZPILUPQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|