C20H21Cl2N5O4S — CID 70072678
(2S)-2-[benzyl-[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]propanoic acid;hydrochloride (PubChem CID 70072678) has the molecular formula C20H21Cl2N5O4S and a molecular weight of 498.39 g/mol. Its IUPAC name is (2S)-2-[benzyl-[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]propanoic acid;hydrochloride.
| Compound Name | (2S)-2-[benzyl-[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70072678 |
| Molecular Formula | C20H21Cl2N5O4S |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | (2S)-2-[benzyl-[4-[(N'-chlorocarbamimidoyl)amino]isoquinolin-7-yl]sulfonylamino]propanoic acid;hydrochloride |
| SMILES | C[C@@H](C(=O)O)N(Cc1ccccc1)S(=O)(=O)c1ccc2c(NC(N)=NCl)cncc2c1.Cl |
| InChI | InChI=1S/C20H20ClN5O4S.ClH/c1-13(19(27)28)26(12-14-5-3-2-4-6-14)31(29,30)16-7-8-17-15(9-16)10-23-11-18(17)24-20(22)25-21;/h2-11,13H,12H2,1H3,(H,27,28)(H3,22,24,25);1H/t13-;/m0./s1 |
| InChIKey | RHORLVOFTJGJMG-ZOWNYOTGSA-N |
| XLogP | 3.20 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|