C20H20ClN5O4S — CID 16657950
(2S)-2-[benzyl-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]propanoic acid (PubChem CID 16657950) has the molecular formula C20H20ClN5O4S and a molecular weight of 461.93 g/mol. Its IUPAC name is (2S)-2-[benzyl-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[benzyl-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 16657950 |
| Molecular Formula | C20H20ClN5O4S |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | (2S)-2-[benzyl-[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]propanoic acid |
| SMILES | C[C@@H](C(=O)O)N(Cc1ccccc1)S(=O)(=O)c1ccc2c(Cl)cnc(N=C(N)N)c2c1 |
| InChI | InChI=1S/C20H20ClN5O4S/c1-12(19(27)28)26(11-13-5-3-2-4-6-13)31(29,30)14-7-8-15-16(9-14)18(25-20(22)23)24-10-17(15)21/h2-10,12H,11H2,1H3,(H,27,28)(H4,22,23,24,25)/t12-/m0/s1 |
| InChIKey | YQUVIYVFJDEFDB-LBPRGKRZSA-N |
| XLogP | 2.46 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|