C14H14ClN5O6S — CID 57257304
(2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]butanedioic acid (PubChem CID 57257304) has the molecular formula C14H14ClN5O6S and a molecular weight of 415.82 g/mol. Its IUPAC name is (2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]butanedioic acid.
| Compound Name | (2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 57257304 |
| Molecular Formula | C14H14ClN5O6S |
| Molecular Weight | 415.82 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | (2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]butanedioic acid |
| SMILES | NC(N)=Nc1ncc(Cl)c2ccc(S(=O)(=O)N[C@@H](CC(=O)O)C(=O)O)cc12 |
| InChI | InChI=1S/C14H14ClN5O6S/c15-9-5-18-12(19-14(16)17)8-3-6(1-2-7(8)9)27(25,26)20-10(13(23)24)4-11(21)22/h1-3,5,10,20H,4H2,(H,21,22)(H,23,24)(H4,16,17,18,19)/t10-/m0/s1 |
| InChIKey | BLOOPJZYRFFEJI-JTQLQIEISA-N |
| XLogP | -0.00 |
| TPSA | 198.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.82 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|