C20H27ClN6O3S — CID 59106441
1-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-N-methyl-N-propylcyclopentane-1-carboxamide (PubChem CID 59106441) has the molecular formula C20H27ClN6O3S and a molecular weight of 467.00 g/mol. Its IUPAC name is 1-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-N-methyl-N-propylcyclopentane-1-carboxamide.
| Compound Name | 1-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-N-methyl-N-propylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 59106441 |
| Molecular Formula | C20H27ClN6O3S |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-N-methyl-N-propylcyclopentane-1-carboxamide |
| SMILES | CCCN(C)C(=O)C1(NS(=O)(=O)c2ccc3c(Cl)cnc(N=C(N)N)c3c2)CCCC1 |
| InChI | InChI=1S/C20H27ClN6O3S/c1-3-10-27(2)18(28)20(8-4-5-9-20)26-31(29,30)13-6-7-14-15(11-13)17(25-19(22)23)24-12-16(14)21/h6-7,11-12,26H,3-5,8-10H2,1-2H3,(H4,22,23,24,25) |
| InChIKey | XAEQWWUIYSAVNZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 143.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|