C16H21Cl2N5O4S — CID 10138777
tert-butyl 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]acetate;hydrochloride (PubChem CID 10138777) has the molecular formula C16H21Cl2N5O4S and a molecular weight of 450.35 g/mol. Its IUPAC name is tert-butyl 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]acetate;hydrochloride.
| Compound Name | tert-butyl 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]acetate;hydrochloride |
|---|---|
| PubChem CID | 10138777 |
| Molecular Formula | C16H21Cl2N5O4S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | tert-butyl 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]acetate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)CNS(=O)(=O)c1ccc2c(Cl)cnc(N=C(N)N)c2c1.Cl |
| InChI | InChI=1S/C16H20ClN5O4S.ClH/c1-16(2,3)26-13(23)8-21-27(24,25)9-4-5-10-11(6-9)14(22-15(18)19)20-7-12(10)17;/h4-7,21H,8H2,1-3H3,(H4,18,19,20,22);1H |
| InChIKey | USRUWXHUOVWOAH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 149.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|