C14H20N4O4 — CID 126819884
tert-butyl 2-[cyclopropylmethyl-(5-nitropyrimidin-2-yl)amino]acetate (PubChem CID 126819884) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is tert-butyl 2-[cyclopropylmethyl-(5-nitropyrimidin-2-yl)amino]acetate.
| Compound Name | tert-butyl 2-[cyclopropylmethyl-(5-nitropyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 126819884 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | tert-butyl 2-[cyclopropylmethyl-(5-nitropyrimidin-2-yl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(CC1CC1)c1ncc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C14H20N4O4/c1-14(2,3)22-12(19)9-17(8-10-4-5-10)13-15-6-11(7-16-13)18(20)21/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | YWCLMNWZUITLQU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|