C26H32N4O2 — CID 4219140
N,N-bis[(4-tert-butylphenyl)methyl]-5-nitropyrimidin-2-amine (PubChem CID 4219140) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N,N-bis[(4-tert-butylphenyl)methyl]-5-nitropyrimidin-2-amine.
| Compound Name | N,N-bis[(4-tert-butylphenyl)methyl]-5-nitropyrimidin-2-amine |
|---|---|
| PubChem CID | 4219140 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | N,N-bis[(4-tert-butylphenyl)methyl]-5-nitropyrimidin-2-amine |
| SMILES | CC(C)(C)c1ccc(CN(Cc2ccc(C(C)(C)C)cc2)c2ncc([N+](=O)[O-])cn2)cc1 |
| InChI | InChI=1S/C26H32N4O2/c1-25(2,3)21-11-7-19(8-12-21)17-29(24-27-15-23(16-28-24)30(31)32)18-20-9-13-22(14-10-20)26(4,5)6/h7-16H,17-18H2,1-6H3 |
| InChIKey | YYMDWHNHIDKQGY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|