C20H28N6O2 — CID 10407691
4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(2-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 10407691) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(2-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(2-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10407691 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(2-methylphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Cc1ccccc1CNc1ncc([N+](=O)[O-])c(NCC2CCC(CN)CC2)n1 |
| InChI | InChI=1S/C20H28N6O2/c1-14-4-2-3-5-17(14)12-23-20-24-13-18(26(27)28)19(25-20)22-11-16-8-6-15(10-21)7-9-16/h2-5,13,15-16H,6-12,21H2,1H3,(H2,22,23,24,25) |
| InChIKey | GXHCTHMMBNJNKU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|