C10H10N6O2 — CID 4231448
4-N-(3-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 4231448) has the molecular formula C10H10N6O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 4-N-(3-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 4231448 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-N-(3-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1cccnc1Nc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N6O2/c1-6-3-2-4-12-9(6)15-10-7(16(17)18)8(11)13-5-14-10/h2-5H,1H3,(H3,11,12,13,14,15) |
| InChIKey | IXBJEHDWQLJIBW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|