C12H14BrN3O4 — CID 104507417
2-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)-(cyclopropylmethyl)amino]acetic acid (PubChem CID 104507417) has the molecular formula C12H14BrN3O4 and a molecular weight of 344.17 g/mol. Its IUPAC name is 2-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)-(cyclopropylmethyl)amino]acetic acid.
| Compound Name | 2-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)-(cyclopropylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 104507417 |
| Molecular Formula | C12H14BrN3O4 |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-[(3-bromo-4-methyl-5-nitro-2-pyridinyl)-(cyclopropylmethyl)amino]acetic acid |
| SMILES | Cc1c([N+](=O)[O-])cnc(N(CC(=O)O)CC2CC2)c1Br |
| InChI | InChI=1S/C12H14BrN3O4/c1-7-9(16(19)20)4-14-12(11(7)13)15(6-10(17)18)5-8-2-3-8/h4,8H,2-3,5-6H2,1H3,(H,17,18) |
| InChIKey | KFUJIZOKBSTUEH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|