C21H26N2O4S — CID 66614080
tert-butyl 2-[4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]cyclohexyl]acetate (PubChem CID 66614080) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is tert-butyl 2-[4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]cyclohexyl]acetate.
| Compound Name | tert-butyl 2-[4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 66614080 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | tert-butyl 2-[4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]cyclohexyl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CCC(c2ncc(-c3ccc([N+](=O)[O-])cc3)s2)CC1 |
| InChI | InChI=1S/C21H26N2O4S/c1-21(2,3)27-19(24)12-14-4-6-16(7-5-14)20-22-13-18(28-20)15-8-10-17(11-9-15)23(25)26/h8-11,13-14,16H,4-7,12H2,1-3H3 |
| InChIKey | CMXWUSBCILROMU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|