C16H18N2O4S — CID 174686257
2,3,3-trimethyl-4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]butanoic acid (PubChem CID 174686257) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2,3,3-trimethyl-4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]butanoic acid.
| Compound Name | 2,3,3-trimethyl-4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 174686257 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2,3,3-trimethyl-4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]butanoic acid |
| SMILES | CC(C(=O)O)C(C)(C)Cc1ncc(-c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C16H18N2O4S/c1-10(15(19)20)16(2,3)8-14-17-9-13(23-14)11-4-6-12(7-5-11)18(21)22/h4-7,9-10H,8H2,1-3H3,(H,19,20) |
| InChIKey | BBOGNXMTYIJLEY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|