C19H20N2O5S — CID 1422834
(4R,5R)-7,7-dimethyl-4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]-1,8-dioxaspiro[4.5]decan-2-one (PubChem CID 1422834) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is (4R,5R)-7,7-dimethyl-4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]-1,8-dioxaspiro[4.5]decan-2-one.
| Compound Name | (4R,5R)-7,7-dimethyl-4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]-1,8-dioxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 1422834 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (4R,5R)-7,7-dimethyl-4-[5-(4-nitrophenyl)-1,3-thiazol-2-yl]-1,8-dioxaspiro[4.5]decan-2-one |
| SMILES | CC1(C)C[C@@]2(CCO1)OC(=O)C[C@H]2c1ncc(-c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C19H20N2O5S/c1-18(2)11-19(7-8-25-18)14(9-16(22)26-19)17-20-10-15(27-17)12-3-5-13(6-4-12)21(23)24/h3-6,10,14H,7-9,11H2,1-2H3/t14-,19+/m0/s1 |
| InChIKey | RAKYOWHHECUVPA-IFXJQAMLSA-N |
| XLogP | 4.08 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|