C7H12N6O3S — CID 83115293
2-[(2-aminopyrimidin-5-yl)sulfonylamino]ethylurea (PubChem CID 83115293) has the molecular formula C7H12N6O3S and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-[(2-aminopyrimidin-5-yl)sulfonylamino]ethylurea.
| Compound Name | 2-[(2-aminopyrimidin-5-yl)sulfonylamino]ethylurea |
|---|---|
| PubChem CID | 83115293 |
| Molecular Formula | C7H12N6O3S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-[(2-aminopyrimidin-5-yl)sulfonylamino]ethylurea |
| SMILES | NC(=O)NCCNS(=O)(=O)c1cnc(N)nc1 |
| InChI | InChI=1S/C7H12N6O3S/c8-6-11-3-5(4-12-6)17(15,16)13-2-1-10-7(9)14/h3-4,13H,1-2H2,(H2,8,11,12)(H3,9,10,14) |
| InChIKey | DJWICLYMSYGDRE-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|