C9H16N6O3S — CID 83115138
2-[[2-(ethylamino)pyrimidin-5-yl]sulfonylamino]ethylurea (PubChem CID 83115138) has the molecular formula C9H16N6O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-[[2-(ethylamino)pyrimidin-5-yl]sulfonylamino]ethylurea.
| Compound Name | 2-[[2-(ethylamino)pyrimidin-5-yl]sulfonylamino]ethylurea |
|---|---|
| PubChem CID | 83115138 |
| Molecular Formula | C9H16N6O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-[[2-(ethylamino)pyrimidin-5-yl]sulfonylamino]ethylurea |
| SMILES | CCNc1ncc(S(=O)(=O)NCCNC(N)=O)cn1 |
| InChI | InChI=1S/C9H16N6O3S/c1-2-11-9-13-5-7(6-14-9)19(17,18)15-4-3-12-8(10)16/h5-6,15H,2-4H2,1H3,(H3,10,12,16)(H,11,13,14) |
| InChIKey | XIWJCYPZZQDJNK-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|