C12H22N4O2S — CID 64582754
N-(2,3-dimethylbutyl)-2-(ethylamino)pyrimidine-5-sulfonamide (PubChem CID 64582754) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-2-(ethylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-(2,3-dimethylbutyl)-2-(ethylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 64582754 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-(2,3-dimethylbutyl)-2-(ethylamino)pyrimidine-5-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)NCC(C)C(C)C)cn1 |
| InChI | InChI=1S/C12H22N4O2S/c1-5-13-12-14-7-11(8-15-12)19(17,18)16-6-10(4)9(2)3/h7-10,16H,5-6H2,1-4H3,(H,13,14,15) |
| InChIKey | XERFJDQPSODDNR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |