C13H25N5O2S — CID 62143309
N-[3-(diethylamino)propyl]-2-(ethylamino)pyrimidine-5-sulfonamide (PubChem CID 62143309) has the molecular formula C13H25N5O2S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-(ethylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-(ethylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62143309 |
| Molecular Formula | C13H25N5O2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-(ethylamino)pyrimidine-5-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)NCCCN(CC)CC)cn1 |
| InChI | InChI=1S/C13H25N5O2S/c1-4-14-13-15-10-12(11-16-13)21(19,20)17-8-7-9-18(5-2)6-3/h10-11,17H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | DQAWODRPJGYYOW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|