C10H17N3O2S3 — CID 114166702
5-[1-(dimethylamino)propan-2-ylsulfamoyl]thiophene-2-carbothioamide (PubChem CID 114166702) has the molecular formula C10H17N3O2S3 and a molecular weight of 307.47 g/mol. Its IUPAC name is 5-[1-(dimethylamino)propan-2-ylsulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[1-(dimethylamino)propan-2-ylsulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 114166702 |
| Molecular Formula | C10H17N3O2S3 |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 5-[1-(dimethylamino)propan-2-ylsulfamoyl]thiophene-2-carbothioamide |
| SMILES | CC(CN(C)C)NS(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C10H17N3O2S3/c1-7(6-13(2)3)12-18(14,15)9-5-4-8(17-9)10(11)16/h4-5,7,12H,6H2,1-3H3,(H2,11,16) |
| InChIKey | KEBHRGKCJUZYQO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|