C11H13N3O3S3 — CID 106388542
5-[1-(5-methyl-1,3-oxazol-2-yl)ethylsulfamoyl]thiophene-2-carbothioamide (PubChem CID 106388542) has the molecular formula C11H13N3O3S3 and a molecular weight of 331.44 g/mol. Its IUPAC name is 5-[1-(5-methyl-1,3-oxazol-2-yl)ethylsulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[1-(5-methyl-1,3-oxazol-2-yl)ethylsulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106388542 |
| Molecular Formula | C11H13N3O3S3 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 5-[1-(5-methyl-1,3-oxazol-2-yl)ethylsulfamoyl]thiophene-2-carbothioamide |
| SMILES | Cc1cnc(C(C)NS(=O)(=O)c2ccc(C(N)=S)s2)o1 |
| InChI | InChI=1S/C11H13N3O3S3/c1-6-5-13-11(17-6)7(2)14-20(15,16)9-4-3-8(19-9)10(12)18/h3-5,7,14H,1-2H3,(H2,12,18) |
| InChIKey | WJAYZIXXUVCVDY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|