C20H22FN3O4S2 — CID 57430282
5-(4-fluorophenyl)sulfonyl-N-(2-imidazol-1-ylethyl)-2-propan-2-ylbenzenesulfonamide (PubChem CID 57430282) has the molecular formula C20H22FN3O4S2 and a molecular weight of 451.55 g/mol. Its IUPAC name is 5-(4-fluorophenyl)sulfonyl-N-(2-imidazol-1-ylethyl)-2-propan-2-ylbenzenesulfonamide.
| Compound Name | 5-(4-fluorophenyl)sulfonyl-N-(2-imidazol-1-ylethyl)-2-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 57430282 |
| Molecular Formula | C20H22FN3O4S2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 5-(4-fluorophenyl)sulfonyl-N-(2-imidazol-1-ylethyl)-2-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)c2ccc(F)cc2)cc1S(=O)(=O)NCCn1ccnc1 |
| InChI | InChI=1S/C20H22FN3O4S2/c1-15(2)19-8-7-18(29(25,26)17-5-3-16(21)4-6-17)13-20(19)30(27,28)23-10-12-24-11-9-22-14-24/h3-9,11,13-15,23H,10,12H2,1-2H3 |
| InChIKey | RKKPPGCGYOFAMW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |