C12H20N2O4S2 — CID 61127178
2-amino-4,5-dimethyl-N-(3-methylsulfonylpropyl)benzenesulfonamide (PubChem CID 61127178) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-amino-4,5-dimethyl-N-(3-methylsulfonylpropyl)benzenesulfonamide.
| Compound Name | 2-amino-4,5-dimethyl-N-(3-methylsulfonylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61127178 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-amino-4,5-dimethyl-N-(3-methylsulfonylpropyl)benzenesulfonamide |
| SMILES | Cc1cc(N)c(S(=O)(=O)NCCCS(C)(=O)=O)cc1C |
| InChI | InChI=1S/C12H20N2O4S2/c1-9-7-11(13)12(8-10(9)2)20(17,18)14-5-4-6-19(3,15)16/h7-8,14H,4-6,13H2,1-3H3 |
| InChIKey | HGSSQUCDAMTRLX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|