C13H22ClFN2O4S — CID 120717462
3-fluoro-4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methylbenzenesulfonamide;hydrochloride (PubChem CID 120717462) has the molecular formula C13H22ClFN2O4S and a molecular weight of 356.85 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methylbenzenesulfonamide;hydrochloride.
| Compound Name | 3-fluoro-4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717462 |
| Molecular Formula | C13H22ClFN2O4S |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methylbenzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccc(OC)c(F)c1C.Cl |
| InChI | InChI=1S/C13H21FN2O4S.ClH/c1-10-12(5-4-11(20-3)13(10)14)21(17,18)16-7-6-15-8-9-19-2;/h4-5,15-16H,6-9H2,1-3H3;1H |
| InChIKey | BDFKKJWTDACSKM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|