C11H18BrClN2O2S2 — CID 119976925
5-bromo-2-methyl-N-(2-pyrrolidin-3-ylethyl)thiophene-3-sulfonamide;hydrochloride (PubChem CID 119976925) has the molecular formula C11H18BrClN2O2S2 and a molecular weight of 389.77 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(2-pyrrolidin-3-ylethyl)thiophene-3-sulfonamide;hydrochloride.
| Compound Name | 5-bromo-2-methyl-N-(2-pyrrolidin-3-ylethyl)thiophene-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119976925 |
| Molecular Formula | C11H18BrClN2O2S2 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 5-bromo-2-methyl-N-(2-pyrrolidin-3-ylethyl)thiophene-3-sulfonamide;hydrochloride |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)NCCC1CCNC1.Cl |
| InChI | InChI=1S/C11H17BrN2O2S2.ClH/c1-8-10(6-11(12)17-8)18(15,16)14-5-3-9-2-4-13-7-9;/h6,9,13-14H,2-5,7H2,1H3;1H |
| InChIKey | HMWJTXFACCUVQL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |