C12H15BrCl3NO2S — CID 106146020
4-bromo-2,6-dichloro-N-(4-chloro-2,2-dimethylbutyl)benzenesulfonamide (PubChem CID 106146020) has the molecular formula C12H15BrCl3NO2S and a molecular weight of 423.59 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(4-chloro-2,2-dimethylbutyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(4-chloro-2,2-dimethylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106146020 |
| Molecular Formula | C12H15BrCl3NO2S |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 420.91 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(4-chloro-2,2-dimethylbutyl)benzenesulfonamide |
| SMILES | CC(C)(CCCl)CNS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C12H15BrCl3NO2S/c1-12(2,3-4-14)7-17-20(18,19)11-9(15)5-8(13)6-10(11)16/h5-6,17H,3-4,7H2,1-2H3 |
| InChIKey | CAVODDJWTOAOEK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|