C13H18Cl2N2O2S — CID 63820548
4-amino-2,6-dichloro-N-[(1-methylcyclopentyl)methyl]benzenesulfonamide (PubChem CID 63820548) has the molecular formula C13H18Cl2N2O2S and a molecular weight of 337.27 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-[(1-methylcyclopentyl)methyl]benzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-[(1-methylcyclopentyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63820548 |
| Molecular Formula | C13H18Cl2N2O2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4-amino-2,6-dichloro-N-[(1-methylcyclopentyl)methyl]benzenesulfonamide |
| SMILES | CC1(CNS(=O)(=O)c2c(Cl)cc(N)cc2Cl)CCCC1 |
| InChI | InChI=1S/C13H18Cl2N2O2S/c1-13(4-2-3-5-13)8-17-20(18,19)12-10(14)6-9(16)7-11(12)15/h6-7,17H,2-5,8,16H2,1H3 |
| InChIKey | XEJAMCKYDCPQFI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|