C11H15N5O — CID 104626468
1-methyl-3-[2-(1-methylpyrazol-3-yl)ethylamino]pyrazin-2-one (PubChem CID 104626468) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is 1-methyl-3-[2-(1-methylpyrazol-3-yl)ethylamino]pyrazin-2-one.
| Compound Name | 1-methyl-3-[2-(1-methylpyrazol-3-yl)ethylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 104626468 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 1-methyl-3-[2-(1-methylpyrazol-3-yl)ethylamino]pyrazin-2-one |
| SMILES | Cn1ccc(CCNc2nccn(C)c2=O)n1 |
| InChI | InChI=1S/C11H15N5O/c1-15-8-6-13-10(11(15)17)12-5-3-9-4-7-16(2)14-9/h4,6-8H,3,5H2,1-2H3,(H,12,13) |
| InChIKey | NGUAUYSHJQPWAJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |