C10H14N6 — CID 104626530
2-N-[2-(1-methylpyrazol-3-yl)ethyl]pyrazine-2,6-diamine (PubChem CID 104626530) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-N-[2-(1-methylpyrazol-3-yl)ethyl]pyrazine-2,6-diamine.
| Compound Name | 2-N-[2-(1-methylpyrazol-3-yl)ethyl]pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 104626530 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-N-[2-(1-methylpyrazol-3-yl)ethyl]pyrazine-2,6-diamine |
| SMILES | Cn1ccc(CCNc2cncc(N)n2)n1 |
| InChI | InChI=1S/C10H14N6/c1-16-5-3-8(15-16)2-4-13-10-7-12-6-9(11)14-10/h3,5-7H,2,4H2,1H3,(H3,11,13,14) |
| InChIKey | NEPJZVKXVMYCBW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |