C11H17N7S — CID 106106929
6-hydrazinyl-N-[2-(1-methylpyrazol-3-yl)ethyl]-2-methylsulfanylpyrimidin-4-amine (PubChem CID 106106929) has the molecular formula C11H17N7S and a molecular weight of 279.37 g/mol. Its IUPAC name is 6-hydrazinyl-N-[2-(1-methylpyrazol-3-yl)ethyl]-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-[2-(1-methylpyrazol-3-yl)ethyl]-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106106929 |
| Molecular Formula | C11H17N7S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 6-hydrazinyl-N-[2-(1-methylpyrazol-3-yl)ethyl]-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(NN)cc(NCCc2ccn(C)n2)n1 |
| InChI | InChI=1S/C11H17N7S/c1-18-6-4-8(17-18)3-5-13-9-7-10(16-12)15-11(14-9)19-2/h4,6-7H,3,5,12H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | QNESYOVOHFAERA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|